C17H13ClN2O5 — CID 144926501
N-[5-(5-chloro-2,4-dihydroxyphenyl)-1,2-oxazol-4-yl]-4-methoxybenzamide (PubChem CID 144926501) has the molecular formula C17H13ClN2O5 and a molecular weight of 360.75 g/mol. Its IUPAC name is N-[5-(5-chloro-2,4-dihydroxyphenyl)-1,2-oxazol-4-yl]-4-methoxybenzamide.
| Compound Name | N-[5-(5-chloro-2,4-dihydroxyphenyl)-1,2-oxazol-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 144926501 |
| Molecular Formula | C17H13ClN2O5 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-[5-(5-chloro-2,4-dihydroxyphenyl)-1,2-oxazol-4-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cnoc2-c2cc(Cl)c(O)cc2O)cc1 |
| InChI | InChI=1S/C17H13ClN2O5/c1-24-10-4-2-9(3-5-10)17(23)20-13-8-19-25-16(13)11-6-12(18)15(22)7-14(11)21/h2-8,21-22H,1H3,(H,20,23) |
| InChIKey | FPJGLHCJIHVRRU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |