C21H13F7N2O3 — CID 144927252
2-[2-(2,4-difluorophenyl)-1,1-difluoro-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 144927252) has the molecular formula C21H13F7N2O3 and a molecular weight of 474.33 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-1,1-difluoro-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 2-[2-(2,4-difluorophenyl)-1,1-difluoro-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 144927252 |
| Molecular Formula | C21H13F7N2O3 |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-1,1-difluoro-3-nitropropyl]-5-[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | O=[N+]([O-])CC(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C21H13F7N2O3/c22-14-4-7-16(18(23)9-14)17(11-30(31)32)20(24,25)19-8-3-13(10-29-19)12-1-5-15(6-2-12)33-21(26,27)28/h1-10,17H,11H2 |
| InChIKey | AQLXOFGYDXFQLK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|