About (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol
(2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol (PubChem CID 144927632) has the molecular formula C14H16F3NO
and a molecular weight of 271.28 g/mol. Its IUPAC name is (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol.
Molecular Properties
| Compound Name | (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol |
| PubChem CID | 144927632 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol |
| SMILES | C=C/N=C(\C)C(F)(F)[C@@](C)(O)c1ccc(F)cc1C |
| InChI | InChI=1S/C14H16F3NO/c1-5-18-10(3)14(16,17)13(4,19)12-7-6-11(15)8-9(12)2/h5-8,19H,1H2,2-4H3/b18-10+/t13-/m0/s1 |
| InChIKey | OUDQJFUMWPYVDS-SGPNVBEDSA-N |
| XLogP | 3.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol?
The IUPAC name of (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol (CID 144927632) is (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol.
What is the SMILES notation for (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol?
The canonical SMILES for (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol is C=C/N=C(\C)C(F)(F)[C@@](C)(O)c1ccc(F)cc1C.
What is the InChIKey of (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol?
The InChIKey is OUDQJFUMWPYVDS-SGPNVBEDSA-N. The full InChI is InChI=1S/C14H16F3NO/c1-5-18-10(3)14(16,17)13(4,19)12-7-6-11(15)8-9(12)2/h5-8,19H,1H2,2-4H3/b18-10+/t13-/m0/s1.
What are the key properties of (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol?
(2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol has a molecular weight of 271.28 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-ethenylimino-3,3-difluoro-2-(4-fluoro-2-methylphenyl)pentan-2-ol is sourced from PubChem (CID 144927632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).