About ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol
ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol (PubChem CID 144927641) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol.
Molecular Properties
| Compound Name | ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol |
| PubChem CID | 144927641 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol |
| SMILES | CC.Cc1ccc(CC(C)(O)c2ccccc2)nc1 |
| InChI | InChI=1S/C15H17NO.C2H6/c1-12-8-9-14(16-11-12)10-15(2,17)13-6-4-3-5-7-13;1-2/h3-9,11,17H,10H2,1-2H3;1-2H3 |
| InChIKey | YTWKYKRTUZXLQT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol?
The IUPAC name of ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol (CID 144927641) is ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol.
What is the SMILES notation for ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol?
The canonical SMILES for ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol is CC.Cc1ccc(CC(C)(O)c2ccccc2)nc1.
What is the InChIKey of ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol?
The InChIKey is YTWKYKRTUZXLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO.C2H6/c1-12-8-9-14(16-11-12)10-15(2,17)13-6-4-3-5-7-13;1-2/h3-9,11,17H,10H2,1-2H3;1-2H3.
What are the key properties of ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol?
ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol has a molecular weight of 257.38 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(5-methyl-2-pyridinyl)-2-phenylpropan-2-ol is sourced from PubChem (CID 144927641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).