C27H36N4O — CID 144927764
(E)-2-cyano-3-[5-[(4Z)-4-[(E)-2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]-1-methylpyrrol-2-yl]but-2-enamide;ethane (PubChem CID 144927764) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[(4Z)-4-[(E)-2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]-1-methylpyrrol-2-yl]but-2-enamide;ethane.
| Compound Name | (E)-2-cyano-3-[5-[(4Z)-4-[(E)-2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]-1-methylpyrrol-2-yl]but-2-enamide;ethane |
|---|---|
| PubChem CID | 144927764 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (E)-2-cyano-3-[5-[(4Z)-4-[(E)-2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]-1-methylpyrrol-2-yl]but-2-enamide;ethane |
| SMILES | C=c1cc(-c2ccc(/C(C)=C(\C#N)C(N)=O)n2C)cc/c1=C\C(=C/C)N(CC)CC.CC |
| InChI | InChI=1S/C25H30N4O.C2H6/c1-7-21(29(8-2)9-3)15-19-10-11-20(14-17(19)4)24-13-12-23(28(24)6)18(5)22(16-26)25(27)30;1-2/h7,10-15H,4,8-9H2,1-3,5-6H3,(H2,27,30);1-2H3/b19-15-,21-7-,22-18+; |
| InChIKey | XMPCPYMJTZXSHX-ONEDIACBSA-N |
| XLogP | 3.94 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|