C26H32N4O2 — CID 144927971
(E)-2-cyano-3-[1-methyl-5-[(4Z)-3-methylidene-4-[(E)-2-morpholin-4-ylbut-2-enylidene]cyclohexa-1,5-dien-1-yl]pyrrol-2-yl]prop-2-enamide;ethane (PubChem CID 144927971) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-methyl-5-[(4Z)-3-methylidene-4-[(E)-2-morpholin-4-ylbut-2-enylidene]cyclohexa-1,5-dien-1-yl]pyrrol-2-yl]prop-2-enamide;ethane.
| Compound Name | (E)-2-cyano-3-[1-methyl-5-[(4Z)-3-methylidene-4-[(E)-2-morpholin-4-ylbut-2-enylidene]cyclohexa-1,5-dien-1-yl]pyrrol-2-yl]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 144927971 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (E)-2-cyano-3-[1-methyl-5-[(4Z)-3-methylidene-4-[(E)-2-morpholin-4-ylbut-2-enylidene]cyclohexa-1,5-dien-1-yl]pyrrol-2-yl]prop-2-enamide;ethane |
| SMILES | C=c1cc(-c2ccc(/C=C(\C#N)C(N)=O)n2C)cc/c1=C/C(=C\C)N1CCOCC1.CC |
| InChI | InChI=1S/C24H26N4O2.C2H6/c1-4-21(28-9-11-30-12-10-28)14-18-5-6-19(13-17(18)2)23-8-7-22(27(23)3)15-20(16-25)24(26)29;1-2/h4-8,13-15H,2,9-12H2,1,3H3,(H2,26,29);1-2H3/b18-14-,20-15+,21-4-; |
| InChIKey | BVVMYYMBECRDLI-DTQFAQITSA-N |
| XLogP | 2.54 |
| TPSA | 84.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|