C27H40N4OS — CID 144928283
(E)-2-aminosulfanyl-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane (PubChem CID 144928283) has the molecular formula C27H40N4OS and a molecular weight of 468.71 g/mol. Its IUPAC name is (E)-2-aminosulfanyl-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane.
| Compound Name | (E)-2-aminosulfanyl-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane |
|---|---|
| PubChem CID | 144928283 |
| Molecular Formula | C27H40N4OS |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (E)-2-aminosulfanyl-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enenitrile;3-methyl-1-[(2-methylpropan-2-yl)oxy]butane |
| SMILES | CC(C)CCOC(C)(C)C.CN1CCN(c2ccc3cc(/C=C(\C#N)SN)ccc3c2)CC1 |
| InChI | InChI=1S/C18H20N4S.C9H20O/c1-21-6-8-22(9-7-21)17-5-4-15-10-14(2-3-16(15)12-17)11-18(13-19)23-20;1-8(2)6-7-10-9(3,4)5/h2-5,10-12H,6-9,20H2,1H3;8H,6-7H2,1-5H3/b18-11+; |
| InChIKey | XLKHOCUMJHDMKI-NWBUNABESA-N |
| XLogP | 5.91 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|