C14H18N4O2 — CID 144928481
2-(2-acetamidophenyl)-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]acetamide (PubChem CID 144928481) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(2-acetamidophenyl)-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]acetamide.
| Compound Name | 2-(2-acetamidophenyl)-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 144928481 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-(2-acetamidophenyl)-N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1CC(=O)N/C(N)=C/C=C\N |
| InChI | InChI=1S/C14H18N4O2/c1-10(19)17-12-6-3-2-5-11(12)9-14(20)18-13(16)7-4-8-15/h2-8H,9,15-16H2,1H3,(H,17,19)(H,18,20)/b8-4-,13-7+ |
| InChIKey | BXRUCHGHYBKMBH-UYPGYXLJSA-N |
| XLogP | 0.58 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|