C20H29N3O2 — CID 144928500
N-[(1E,3Z)-1,4-diamino-4-cycloheptylbuta-1,3-dienyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 144928500) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diamino-4-cycloheptylbuta-1,3-dienyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(1E,3Z)-1,4-diamino-4-cycloheptylbuta-1,3-dienyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 144928500 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[(1E,3Z)-1,4-diamino-4-cycloheptylbuta-1,3-dienyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=C/C=C(\N)C2CCCCCC2)cc1 |
| InChI | InChI=1S/C20H29N3O2/c1-25-17-10-8-15(9-11-17)14-20(24)23-19(22)13-12-18(21)16-6-4-2-3-5-7-16/h8-13,16H,2-7,14,21-22H2,1H3,(H,23,24)/b18-12-,19-13+ |
| InChIKey | FNXBYKAMXVHPIF-MGYAYREDSA-N |
| XLogP | 2.97 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|