C22H30F6N6O2 — CID 144928609
N-(6-cyclohexylpyridazin-3-yl)-4,4,4-trifluorobutanamide;N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide (PubChem CID 144928609) has the molecular formula C22H30F6N6O2 and a molecular weight of 524.51 g/mol. Its IUPAC name is N-(6-cyclohexylpyridazin-3-yl)-4,4,4-trifluorobutanamide;N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-(6-cyclohexylpyridazin-3-yl)-4,4,4-trifluorobutanamide;N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 144928609 |
| Molecular Formula | C22H30F6N6O2 |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | N-(6-cyclohexylpyridazin-3-yl)-4,4,4-trifluorobutanamide;N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide |
| SMILES | N/C=C\C=C(/N)NC(=O)CCC(F)(F)F.O=C(CCC(F)(F)F)Nc1ccc(C2CCCCC2)nn1 |
| InChI | InChI=1S/C14H18F3N3O.C8H12F3N3O/c15-14(16,17)9-8-13(21)18-12-7-6-11(19-20-12)10-4-2-1-3-5-10;9-8(10,11)4-3-7(15)14-6(13)2-1-5-12/h6-7,10H,1-5,8-9H2,(H,18,20,21);1-2,5H,3-4,12-13H2,(H,14,15)/b;5-1-,6-2+ |
| InChIKey | WACFDXCSVGUXPA-AWFBGGPASA-N |
| XLogP | 4.52 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|