C8H12F3N3O — CID 144928611
N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide (PubChem CID 144928611) has the molecular formula C8H12F3N3O and a molecular weight of 223.20 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 144928611 |
| Molecular Formula | C8H12F3N3O |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]-4,4,4-trifluorobutanamide |
| SMILES | N/C=C\C=C(/N)NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O/c9-8(10,11)4-3-7(15)14-6(13)2-1-5-12/h1-2,5H,3-4,12-13H2,(H,14,15)/b5-1-,6-2+ |
| InChIKey | CPDNBUARIITBHJ-SOSXVSKCSA-N |
| XLogP | 0.72 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|