C33H35N5 — CID 144929366
N-[3-[5-(5-benzyl-3-pyridinyl)-2-methylphenyl]-3-methyliminoprop-1-en-2-yl]-2-piperidin-1-ylpyridin-4-amine (PubChem CID 144929366) has the molecular formula C33H35N5 and a molecular weight of 501.68 g/mol. Its IUPAC name is N-[3-[5-(5-benzyl-3-pyridinyl)-2-methylphenyl]-3-methyliminoprop-1-en-2-yl]-2-piperidin-1-ylpyridin-4-amine.
| Compound Name | N-[3-[5-(5-benzyl-3-pyridinyl)-2-methylphenyl]-3-methyliminoprop-1-en-2-yl]-2-piperidin-1-ylpyridin-4-amine |
|---|---|
| PubChem CID | 144929366 |
| Molecular Formula | C33H35N5 |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N-[3-[5-(5-benzyl-3-pyridinyl)-2-methylphenyl]-3-methyliminoprop-1-en-2-yl]-2-piperidin-1-ylpyridin-4-amine |
| SMILES | C=C(Nc1ccnc(N2CCCCC2)c1)/C(=N\C)c1cc(-c2cncc(Cc3ccccc3)c2)ccc1C |
| InChI | InChI=1S/C33H35N5/c1-24-12-13-28(29-19-27(22-35-23-29)18-26-10-6-4-7-11-26)20-31(24)33(34-3)25(2)37-30-14-15-36-32(21-30)38-16-8-5-9-17-38/h4,6-7,10-15,19-23H,2,5,8-9,16-18H2,1,3H3,(H,36,37)/b34-33+ |
| InChIKey | RYOAZWYXGPVKQE-JEIPZWNWSA-N |
| XLogP | 7.08 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|