About 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine
6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine (PubChem CID 144929403) has the molecular formula C12H13FN2
and a molecular weight of 204.25 g/mol. Its IUPAC name is 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine |
| PubChem CID | 144929403 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine |
| SMILES | Nc1ccc(CC2=C(F)CCC=C2)nc1 |
| InChI | InChI=1S/C12H13FN2/c13-12-4-2-1-3-9(12)7-11-6-5-10(14)8-15-11/h1,3,5-6,8H,2,4,7,14H2 |
| InChIKey | JFNDDIOUUQWCRC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine?
The IUPAC name of 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine (CID 144929403) is 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine.
What is the SMILES notation for 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine?
The canonical SMILES for 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine is Nc1ccc(CC2=C(F)CCC=C2)nc1.
What is the InChIKey of 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine?
The InChIKey is JFNDDIOUUQWCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2/c13-12-4-2-1-3-9(12)7-11-6-5-10(14)8-15-11/h1,3,5-6,8H,2,4,7,14H2.
What are the key properties of 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine?
6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine has a molecular weight of 204.25 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-fluorocyclohexa-1,5-dien-1-yl)methyl]pyridin-3-amine is sourced from PubChem (CID 144929403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).