C25H18F3N7O2 — CID 144929477
N-[3-[(Z)-4-amino-4-oxobut-2-enimidoyl]-1-phenylpyrazol-5-yl]-3-pyrimidin-2-yl-4-(trifluoromethyl)benzamide (PubChem CID 144929477) has the molecular formula C25H18F3N7O2 and a molecular weight of 505.46 g/mol. Its IUPAC name is N-[3-[(Z)-4-amino-4-oxobut-2-enimidoyl]-1-phenylpyrazol-5-yl]-3-pyrimidin-2-yl-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[(Z)-4-amino-4-oxobut-2-enimidoyl]-1-phenylpyrazol-5-yl]-3-pyrimidin-2-yl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 144929477 |
| Molecular Formula | C25H18F3N7O2 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[3-[(Z)-4-amino-4-oxobut-2-enimidoyl]-1-phenylpyrazol-5-yl]-3-pyrimidin-2-yl-4-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(/C=C\C(N)=O)c1cc(NC(=O)c2ccc(C(F)(F)F)c(-c3ncccn3)c2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H18F3N7O2/c26-25(27,28)18-8-7-15(13-17(18)23-31-11-4-12-32-23)24(37)33-22-14-20(19(29)9-10-21(30)36)34-35(22)16-5-2-1-3-6-16/h1-14,29H,(H2,30,36)(H,33,37)/b10-9-,29-19- |
| InChIKey | NOGOXWKQLBXAOX-ZZQUBCPBSA-N |
| XLogP | 4.01 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|