About (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane
(2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane (PubChem CID 144929653) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane.
Molecular Properties
| Compound Name | (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane |
| PubChem CID | 144929653 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane |
| SMILES | CCC.C[C@@H]1CN(C2CC3CCC(C2)N3)C[C@H](C)O1 |
| InChI | InChI=1S/C13H24N2O.C3H8/c1-9-7-15(8-10(2)16-9)13-5-11-3-4-12(6-13)14-11;1-3-2/h9-14H,3-8H2,1-2H3;3H2,1-2H3/t9-,10+,11?,12?,13?; |
| InChIKey | KAPOPQYSMIAENT-MDRAYUKYSA-N |
| XLogP | 2.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane?
The IUPAC name of (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane (CID 144929653) is (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane.
What is the SMILES notation for (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane?
The canonical SMILES for (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane is CCC.C[C@@H]1CN(C2CC3CCC(C2)N3)C[C@H](C)O1.
What is the InChIKey of (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane?
The InChIKey is KAPOPQYSMIAENT-MDRAYUKYSA-N. The full InChI is InChI=1S/C13H24N2O.C3H8/c1-9-7-15(8-10(2)16-9)13-5-11-3-4-12(6-13)14-11;1-3-2/h9-14H,3-8H2,1-2H3;3H2,1-2H3/t9-,10+,11?,12?,13?;.
What are the key properties of (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane?
(2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane has a molecular weight of 268.44 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-(8-azabicyclo[3.2.1]octan-3-yl)-2,6-dimethylmorpholine;propane is sourced from PubChem (CID 144929653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).