About (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane
(3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane (PubChem CID 144931713) has the molecular formula C12H18F2O
and a molecular weight of 216.27 g/mol. Its IUPAC name is (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane.
Molecular Properties
| Compound Name | (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane |
| PubChem CID | 144931713 |
| Molecular Formula | C12H18F2O |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane |
| SMILES | C=C(C)/C=C1\C(=C)OCCC1(F)F.CC |
| InChI | InChI=1S/C10H12F2O.C2H6/c1-7(2)6-9-8(3)13-5-4-10(9,11)12;1-2/h6H,1,3-5H2,2H3;1-2H3/b9-6+; |
| InChIKey | MBIIRCLIGFIUFJ-MLBSPLJJSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane?
The IUPAC name of (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane (CID 144931713) is (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane.
What is the SMILES notation for (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane?
The canonical SMILES for (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane is C=C(C)/C=C1\C(=C)OCCC1(F)F.CC.
What is the InChIKey of (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane?
The InChIKey is MBIIRCLIGFIUFJ-MLBSPLJJSA-N. The full InChI is InChI=1S/C10H12F2O.C2H6/c1-7(2)6-9-8(3)13-5-4-10(9,11)12;1-2/h6H,1,3-5H2,2H3;1-2H3/b9-6+;.
What are the key properties of (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane?
(3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane has a molecular weight of 216.27 g/mol, XLogP of 4.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4,4-difluoro-2-methylidene-3-(2-methylprop-2-enylidene)oxane;ethane is sourced from PubChem (CID 144931713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).