About (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane
(3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane (PubChem CID 144931802) has the molecular formula C9H14BrCl
and a molecular weight of 237.57 g/mol. Its IUPAC name is (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane.
Molecular Properties
| Compound Name | (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane |
| PubChem CID | 144931802 |
| Molecular Formula | C9H14BrCl |
| Molecular Weight | 237.57 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane |
| SMILES | C=C(Cl)/C=C(/C)C(=C)Br.CC |
| InChI | InChI=1S/C7H8BrCl.C2H6/c1-5(7(3)8)4-6(2)9;1-2/h4H,2-3H2,1H3;1-2H3/b5-4-; |
| InChIKey | MVZXCIILJGXCCW-MKWAYWHRSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane?
The IUPAC name of (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane (CID 144931802) is (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane.
What is the SMILES notation for (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane?
The canonical SMILES for (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane is C=C(Cl)/C=C(/C)C(=C)Br.CC.
What is the InChIKey of (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane?
The InChIKey is MVZXCIILJGXCCW-MKWAYWHRSA-N. The full InChI is InChI=1S/C7H8BrCl.C2H6/c1-5(7(3)8)4-6(2)9;1-2/h4H,2-3H2,1H3;1-2H3/b5-4-;.
What are the key properties of (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane?
(3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane has a molecular weight of 237.57 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-bromo-5-chloro-3-methylhexa-1,3,5-triene;ethane is sourced from PubChem (CID 144931802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).