C25H26N2OS — CID 144932337
2-[(5R)-5,7,10-trimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetaldehyde (PubChem CID 144932337) has the molecular formula C25H26N2OS and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[(5R)-5,7,10-trimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetaldehyde.
| Compound Name | 2-[(5R)-5,7,10-trimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 144932337 |
| Molecular Formula | C25H26N2OS |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[(5R)-5,7,10-trimethyl-9-(4-methylphenyl)-6-methylsulfanyl-5H-benzo[h][1,6]naphthyridin-8-yl]acetaldehyde |
| SMILES | CSN1c2c(C)c(CC=O)c(-c3ccc(C)cc3)c(C)c2-c2ncccc2[C@H]1C |
| InChI | InChI=1S/C25H26N2OS/c1-15-8-10-19(11-9-15)22-17(3)23-24-21(7-6-13-26-24)18(4)27(29-5)25(23)16(2)20(22)12-14-28/h6-11,13-14,18H,12H2,1-5H3/t18-/m1/s1 |
| InChIKey | QZPPBCNEESQJMM-GOSISDBHSA-N |
| XLogP | 6.24 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|