About 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione
4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione (PubChem CID 144933188) has the molecular formula C4H6N2S2
and a molecular weight of 146.24 g/mol. Its IUPAC name is 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione.
Molecular Properties
| Compound Name | 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione |
| PubChem CID | 144933188 |
| Molecular Formula | C4H6N2S2 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione |
| SMILES | Cc1c(S)[nH][nH]c1=S |
| InChI | InChI=1S/C4H6N2S2/c1-2-3(7)5-6-4(2)8/h1H3,(H3,5,6,7,8) |
| InChIKey | DBRYLTWHPUIVAF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione?
The IUPAC name of 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione (CID 144933188) is 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione.
What is the SMILES notation for 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione?
The canonical SMILES for 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione is Cc1c(S)[nH][nH]c1=S.
What is the InChIKey of 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione?
The InChIKey is DBRYLTWHPUIVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S2/c1-2-3(7)5-6-4(2)8/h1H3,(H3,5,6,7,8).
What are the key properties of 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione?
4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione has a molecular weight of 146.24 g/mol, XLogP of 1.67, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-sulfanyl-1,2-dihydropyrazole-3-thione is sourced from PubChem (CID 144933188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).