About ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one
ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one (PubChem CID 144934097) has the molecular formula C12H16OS2
and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one.
Molecular Properties
| Compound Name | ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one |
| PubChem CID | 144934097 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one |
| SMILES | CC.CC(C)C(=O)c1cc2cscc2s1 |
| InChI | InChI=1S/C10H10OS2.C2H6/c1-6(2)10(11)8-3-7-4-12-5-9(7)13-8;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | KNAJWNQITVMOEK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one?
The IUPAC name of ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one (CID 144934097) is ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one.
What is the SMILES notation for ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one?
The canonical SMILES for ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one is CC.CC(C)C(=O)c1cc2cscc2s1.
What is the InChIKey of ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one?
The InChIKey is KNAJWNQITVMOEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10OS2.C2H6/c1-6(2)10(11)8-3-7-4-12-5-9(7)13-8;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one?
ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one has a molecular weight of 240.39 g/mol, XLogP of 4.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1-thieno[2,3-c]thiophen-2-ylpropan-1-one is sourced from PubChem (CID 144934097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).