About 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane (PubChem CID 144934453) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane.
Molecular Properties
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane |
| PubChem CID | 144934453 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane |
| SMILES | C=C/C=C\c1c(N)n[nH]c1C=C.CC |
| InChI | InChI=1S/C9H11N3.C2H6/c1-3-5-6-7-8(4-2)11-12-9(7)10;1-2/h3-6H,1-2H2,(H3,10,11,12);1-2H3/b6-5-; |
| InChIKey | PRHCYRIMCINQNF-YSMBQZINSA-N |
| XLogP | 2.86 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane?
The IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane (CID 144934453) is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane.
What is the SMILES notation for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane?
The canonical SMILES for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane is C=C/C=C\c1c(N)n[nH]c1C=C.CC.
What is the InChIKey of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane?
The InChIKey is PRHCYRIMCINQNF-YSMBQZINSA-N. The full InChI is InChI=1S/C9H11N3.C2H6/c1-3-5-6-7-8(4-2)11-12-9(7)10;1-2/h3-6H,1-2H2,(H3,10,11,12);1-2H3/b6-5-;.
What are the key properties of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane?
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane has a molecular weight of 191.28 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine;ethane is sourced from PubChem (CID 144934453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).