About 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine (PubChem CID 144934454) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine |
| PubChem CID | 144934454 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine |
| SMILES | C=C/C=C\c1c(N)n[nH]c1C=C |
| InChI | InChI=1S/C9H11N3/c1-3-5-6-7-8(4-2)11-12-9(7)10/h3-6H,1-2H2,(H3,10,11,12)/b6-5- |
| InChIKey | OSWLVEKWQUFMSA-WAYWQWQTSA-N |
| XLogP | 1.83 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine?
The IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine (CID 144934454) is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine.
What is the SMILES notation for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine?
The canonical SMILES for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine is C=C/C=C\c1c(N)n[nH]c1C=C.
What is the InChIKey of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine?
The InChIKey is OSWLVEKWQUFMSA-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H11N3/c1-3-5-6-7-8(4-2)11-12-9(7)10/h3-6H,1-2H2,(H3,10,11,12)/b6-5-.
What are the key properties of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine?
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine has a molecular weight of 161.21 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1H-pyrazol-3-amine is sourced from PubChem (CID 144934454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).