About ethane;3,4,6-trifluoro-N-methylpyridin-2-amine
ethane;3,4,6-trifluoro-N-methylpyridin-2-amine (PubChem CID 144934815) has the molecular formula C8H11F3N2
and a molecular weight of 192.18 g/mol. Its IUPAC name is ethane;3,4,6-trifluoro-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | ethane;3,4,6-trifluoro-N-methylpyridin-2-amine |
| PubChem CID | 144934815 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | ethane;3,4,6-trifluoro-N-methylpyridin-2-amine |
| SMILES | CC.CNc1nc(F)cc(F)c1F |
| InChI | InChI=1S/C6H5F3N2.C2H6/c1-10-6-5(9)3(7)2-4(8)11-6;1-2/h2H,1H3,(H,10,11);1-2H3 |
| InChIKey | AWKYODNEOPAIGK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethane;3,4,6-trifluoro-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3,4,6-trifluoro-N-methylpyridin-2-amine?
The IUPAC name of ethane;3,4,6-trifluoro-N-methylpyridin-2-amine (CID 144934815) is ethane;3,4,6-trifluoro-N-methylpyridin-2-amine.
What is the SMILES notation for ethane;3,4,6-trifluoro-N-methylpyridin-2-amine?
The canonical SMILES for ethane;3,4,6-trifluoro-N-methylpyridin-2-amine is CC.CNc1nc(F)cc(F)c1F.
What is the InChIKey of ethane;3,4,6-trifluoro-N-methylpyridin-2-amine?
The InChIKey is AWKYODNEOPAIGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2.C2H6/c1-10-6-5(9)3(7)2-4(8)11-6;1-2/h2H,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;3,4,6-trifluoro-N-methylpyridin-2-amine?
ethane;3,4,6-trifluoro-N-methylpyridin-2-amine has a molecular weight of 192.18 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3,4,6-trifluoro-N-methylpyridin-2-amine is sourced from PubChem (CID 144934815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).