C12H18N4O6 — CID 144935309
5-(2-oxopropylideneamino)-6-[[(2S,3R)-2,3,5-trihydroxypentyl]amino]-1H-pyrimidine-2,4-dione (PubChem CID 144935309) has the molecular formula C12H18N4O6 and a molecular weight of 314.30 g/mol. Its IUPAC name is 5-(2-oxopropylideneamino)-6-[[(2S,3R)-2,3,5-trihydroxypentyl]amino]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2-oxopropylideneamino)-6-[[(2S,3R)-2,3,5-trihydroxypentyl]amino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 144935309 |
| Molecular Formula | C12H18N4O6 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 5-(2-oxopropylideneamino)-6-[[(2S,3R)-2,3,5-trihydroxypentyl]amino]-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)/C=N/c1c(NC[C@H](O)[C@H](O)CCO)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H18N4O6/c1-6(18)4-13-9-10(15-12(22)16-11(9)21)14-5-8(20)7(19)2-3-17/h4,7-8,17,19-20H,2-3,5H2,1H3,(H3,14,15,16,21,22)/b13-4+/t7-,8+/m1/s1 |
| InChIKey | LFFDRPXUQKVYPE-ZGBHKRMMSA-N |
| XLogP | -2.13 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|