About 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide
5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide (PubChem CID 144935364) has the molecular formula C11H8F3N3OS2
and a molecular weight of 319.33 g/mol. Its IUPAC name is 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 144935364 |
| Molecular Formula | C11H8F3N3OS2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC(F)(F)F)c1nc(-c2nccs2)sc1C1CC1 |
| InChI | InChI=1S/C11H8F3N3OS2/c12-11(13,14)17-8(18)6-7(5-1-2-5)20-10(16-6)9-15-3-4-19-9/h3-5H,1-2H2,(H,17,18) |
| InChIKey | YIHYNPQGOXILPC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide (CID 144935364) is 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide is O=C(NC(F)(F)F)c1nc(-c2nccs2)sc1C1CC1.
What is the InChIKey of 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide?
The InChIKey is YIHYNPQGOXILPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F3N3OS2/c12-11(13,14)17-8(18)6-7(5-1-2-5)20-10(16-6)9-15-3-4-19-9/h3-5H,1-2H2,(H,17,18).
What are the key properties of 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide?
5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide has a molecular weight of 319.33 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 144935364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).