C14H19NO — CID 144935413
(3E)-4-amino-2-(2,5-dimethylcyclohepta-2,4,6-trien-1-yl)penta-1,3-dien-3-ol (PubChem CID 144935413) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3E)-4-amino-2-(2,5-dimethylcyclohepta-2,4,6-trien-1-yl)penta-1,3-dien-3-ol.
| Compound Name | (3E)-4-amino-2-(2,5-dimethylcyclohepta-2,4,6-trien-1-yl)penta-1,3-dien-3-ol |
|---|---|
| PubChem CID | 144935413 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3E)-4-amino-2-(2,5-dimethylcyclohepta-2,4,6-trien-1-yl)penta-1,3-dien-3-ol |
| SMILES | C=C(/C(O)=C(/C)N)C1C=CC(C)=CC=C1C |
| InChI | InChI=1S/C14H19NO/c1-9-5-7-10(2)13(8-6-9)11(3)14(16)12(4)15/h5-8,13,16H,3,15H2,1-2,4H3/b14-12+ |
| InChIKey | XIFOEFVHXUCFLL-WYMLVPIESA-N |
| XLogP | 3.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|