C15H19N3O3 — CID 14493571
1-(4-oxoheptan-3-yl)-4-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 14493571) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(4-oxoheptan-3-yl)-4-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-(4-oxoheptan-3-yl)-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 14493571 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(4-oxoheptan-3-yl)-4-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCC(=O)C(CC)n1[nH]c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C15H19N3O3/c1-3-8-13(19)12(4-2)18-15(21)17(14(20)16-18)11-9-6-5-7-10-11/h5-7,9-10,12H,3-4,8H2,1-2H3,(H,16,20) |
| InChIKey | HCJPPJAGWJKLKL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |