C25H38F3N — CID 144936193
N-butan-2-yl-6-hex-3-en-2-yl-N-[(2E,4E)-3-methyl-5-(trifluoromethyl)hepta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine (PubChem CID 144936193) has the molecular formula C25H38F3N and a molecular weight of 409.58 g/mol. Its IUPAC name is N-butan-2-yl-6-hex-3-en-2-yl-N-[(2E,4E)-3-methyl-5-(trifluoromethyl)hepta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine.
| Compound Name | N-butan-2-yl-6-hex-3-en-2-yl-N-[(2E,4E)-3-methyl-5-(trifluoromethyl)hepta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144936193 |
| Molecular Formula | C25H38F3N |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | N-butan-2-yl-6-hex-3-en-2-yl-N-[(2E,4E)-3-methyl-5-(trifluoromethyl)hepta-2,4-dien-2-yl]cyclohexa-1,3-dien-1-amine |
| SMILES | CCC=CC(C)C1CC=CC=C1N(/C(C)=C(C)/C=C(\CC)C(F)(F)F)C(C)CC |
| InChI | InChI=1S/C25H38F3N/c1-8-11-14-18(4)23-15-12-13-16-24(23)29(20(6)9-2)21(7)19(5)17-22(10-3)25(26,27)28/h11-14,16-18,20,23H,8-10,15H2,1-7H3/b14-11?,21-19+,22-17+ |
| InChIKey | HJGMHDXJAHHBOX-FAIJDIONSA-N |
| XLogP | 8.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|