C19H13N5 — CID 144936375
4-(benzimidazolo[1,2-a]benzimidazol-5-yl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 144936375) has the molecular formula C19H13N5 and a molecular weight of 311.35 g/mol. Its IUPAC name is 4-(benzimidazolo[1,2-a]benzimidazol-5-yl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-(benzimidazolo[1,2-a]benzimidazol-5-yl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 144936375 |
| Molecular Formula | C19H13N5 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-(benzimidazolo[1,2-a]benzimidazol-5-yl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C=C(n2c3ccccc3n3c4ccccc4nc23)C=C/C1=N\[H] |
| InChI | InChI=1S/C19H13N5/c20-13-10-9-12(11-14(13)21)23-17-7-3-4-8-18(17)24-16-6-2-1-5-15(16)22-19(23)24/h1-11,20-21H/b20-13+,21-14- |
| InChIKey | WBHIXTDSBMKZHP-NAWSQEDCSA-N |
| XLogP | 3.89 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|