C21H26N4O4 — CID 144936513
N-[4-[[amino(phenyl)methylidene]amino]-2-methyl-4-oxobutan-2-yl]-6-(2-methoxyethoxy)pyridine-2-carboxamide (PubChem CID 144936513) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[4-[[amino(phenyl)methylidene]amino]-2-methyl-4-oxobutan-2-yl]-6-(2-methoxyethoxy)pyridine-2-carboxamide.
| Compound Name | N-[4-[[amino(phenyl)methylidene]amino]-2-methyl-4-oxobutan-2-yl]-6-(2-methoxyethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 144936513 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[4-[[amino(phenyl)methylidene]amino]-2-methyl-4-oxobutan-2-yl]-6-(2-methoxyethoxy)pyridine-2-carboxamide |
| SMILES | COCCOc1cccc(C(=O)NC(C)(C)CC(=O)/N=C(\N)c2ccccc2)n1 |
| InChI | InChI=1S/C21H26N4O4/c1-21(2,14-17(26)24-19(22)15-8-5-4-6-9-15)25-20(27)16-10-7-11-18(23-16)29-13-12-28-3/h4-11H,12-14H2,1-3H3,(H,25,27)(H2,22,24,26) |
| InChIKey | IHRHNAJZEQCUNJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|