C17H28N2O2 — CID 144936692
ethane;methyl 2-[4-[(3-aminophenyl)methyl]piperidin-1-yl]acetate (PubChem CID 144936692) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethane;methyl 2-[4-[(3-aminophenyl)methyl]piperidin-1-yl]acetate.
| Compound Name | ethane;methyl 2-[4-[(3-aminophenyl)methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 144936692 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | ethane;methyl 2-[4-[(3-aminophenyl)methyl]piperidin-1-yl]acetate |
| SMILES | CC.COC(=O)CN1CCC(Cc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C15H22N2O2.C2H6/c1-19-15(18)11-17-7-5-12(6-8-17)9-13-3-2-4-14(16)10-13;1-2/h2-4,10,12H,5-9,11,16H2,1H3;1-2H3 |
| InChIKey | RGKBRGCDGMYRBL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|