C23H26F3NOS — CID 144937190
2,2-dimethyl-4-[2-piperidin-4-yl-4-(trifluoromethyl)phenyl]-3,4-dihydrochromene-7-thiol (PubChem CID 144937190) has the molecular formula C23H26F3NOS and a molecular weight of 421.53 g/mol. Its IUPAC name is 2,2-dimethyl-4-[2-piperidin-4-yl-4-(trifluoromethyl)phenyl]-3,4-dihydrochromene-7-thiol.
| Compound Name | 2,2-dimethyl-4-[2-piperidin-4-yl-4-(trifluoromethyl)phenyl]-3,4-dihydrochromene-7-thiol |
|---|---|
| PubChem CID | 144937190 |
| Molecular Formula | C23H26F3NOS |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2,2-dimethyl-4-[2-piperidin-4-yl-4-(trifluoromethyl)phenyl]-3,4-dihydrochromene-7-thiol |
| SMILES | CC1(C)CC(c2ccc(C(F)(F)F)cc2C2CCNCC2)c2ccc(S)cc2O1 |
| InChI | InChI=1S/C23H26F3NOS/c1-22(2)13-20(18-6-4-16(29)12-21(18)28-22)17-5-3-15(23(24,25)26)11-19(17)14-7-9-27-10-8-14/h3-6,11-12,14,20,27,29H,7-10,13H2,1-2H3 |
| InChIKey | BJVXZIAVZGIOGJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|