C18H14Cl2N2O2S2 — CID 144937206
N-[[4-(2,4-dichlorophenoxy)-3,4-dihydro-2H-chromen-7-yl]sulfanyl]-1,3-thiazol-2-amine (PubChem CID 144937206) has the molecular formula C18H14Cl2N2O2S2 and a molecular weight of 425.36 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenoxy)-3,4-dihydro-2H-chromen-7-yl]sulfanyl]-1,3-thiazol-2-amine.
| Compound Name | N-[[4-(2,4-dichlorophenoxy)-3,4-dihydro-2H-chromen-7-yl]sulfanyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 144937206 |
| Molecular Formula | C18H14Cl2N2O2S2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | N-[[4-(2,4-dichlorophenoxy)-3,4-dihydro-2H-chromen-7-yl]sulfanyl]-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(OC2CCOc3cc(SNc4nccs4)ccc32)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N2O2S2/c19-11-1-4-16(14(20)9-11)24-15-5-7-23-17-10-12(2-3-13(15)17)26-22-18-21-6-8-25-18/h1-4,6,8-10,15H,5,7H2,(H,21,22) |
| InChIKey | HQEDWRMIJOXCEM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|