About 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate
2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate (PubChem CID 144938097) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate |
| PubChem CID | 144938097 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate |
| SMILES | CN(C)CCOC(=O)C(CC(C)(C)C)C(C)(C)O |
| InChI | InChI=1S/C14H29NO3/c1-13(2,3)10-11(14(4,5)17)12(16)18-9-8-15(6)7/h11,17H,8-10H2,1-7H3 |
| InChIKey | JRWJKOBEWQZZFS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate?
The IUPAC name of 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate (CID 144938097) is 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate is CN(C)CCOC(=O)C(CC(C)(C)C)C(C)(C)O.
What is the InChIKey of 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate?
The InChIKey is JRWJKOBEWQZZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3/c1-13(2,3)10-11(14(4,5)17)12(16)18-9-8-15(6)7/h11,17H,8-10H2,1-7H3.
What are the key properties of 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate?
2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate has a molecular weight of 259.39 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-(2-hydroxypropan-2-yl)-4,4-dimethylpentanoate is sourced from PubChem (CID 144938097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).