About 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate
2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate (PubChem CID 144938123) has the molecular formula C13H26FNO2
and a molecular weight of 247.35 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate |
| PubChem CID | 144938123 |
| Molecular Formula | C13H26FNO2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate |
| SMILES | CN(C)CCOC(=O)C(C)(CF)CC(C)(C)C |
| InChI | InChI=1S/C13H26FNO2/c1-12(2,3)9-13(4,10-14)11(16)17-8-7-15(5)6/h7-10H2,1-6H3 |
| InChIKey | CIWQLVTVDMZWQZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate?
The IUPAC name of 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate (CID 144938123) is 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate is CN(C)CCOC(=O)C(C)(CF)CC(C)(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate?
The InChIKey is CIWQLVTVDMZWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26FNO2/c1-12(2,3)9-13(4,10-14)11(16)17-8-7-15(5)6/h7-10H2,1-6H3.
What are the key properties of 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate?
2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate has a molecular weight of 247.35 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-(fluoromethyl)-2,4,4-trimethylpentanoate is sourced from PubChem (CID 144938123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).