About ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate
ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate (PubChem CID 144938197) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate.
Molecular Properties
| Compound Name | ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate |
| PubChem CID | 144938197 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate |
| SMILES | C=C(S/C=N/C)C(C)C.CC |
| InChI | InChI=1S/C7H13NS.C2H6/c1-6(2)7(3)9-5-8-4;1-2/h5-6H,3H2,1-2,4H3;1-2H3/b8-5+; |
| InChIKey | ZTBKOMJCPOSFLO-HAAWTFQLSA-N |
| XLogP | 3.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate?
The IUPAC name of ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate (CID 144938197) is ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate.
What is the SMILES notation for ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate?
The canonical SMILES for ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate is C=C(S/C=N/C)C(C)C.CC.
What is the InChIKey of ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate?
The InChIKey is ZTBKOMJCPOSFLO-HAAWTFQLSA-N. The full InChI is InChI=1S/C7H13NS.C2H6/c1-6(2)7(3)9-5-8-4;1-2/h5-6H,3H2,1-2,4H3;1-2H3/b8-5+;.
What are the key properties of ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate?
ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate has a molecular weight of 173.32 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylbut-1-en-2-yl N-methylmethanimidothioate is sourced from PubChem (CID 144938197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).