C16H23ClN4O — CID 144938251
[2-[(2Z)-2-(2-aminoethylidene)hydrazinyl]-5-methylphenyl]-[2-(chloromethyl)piperidin-1-yl]methanone (PubChem CID 144938251) has the molecular formula C16H23ClN4O and a molecular weight of 322.84 g/mol. Its IUPAC name is [2-[(2Z)-2-(2-aminoethylidene)hydrazinyl]-5-methylphenyl]-[2-(chloromethyl)piperidin-1-yl]methanone.
| Compound Name | [2-[(2Z)-2-(2-aminoethylidene)hydrazinyl]-5-methylphenyl]-[2-(chloromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 144938251 |
| Molecular Formula | C16H23ClN4O |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [2-[(2Z)-2-(2-aminoethylidene)hydrazinyl]-5-methylphenyl]-[2-(chloromethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(N/N=C\CN)c(C(=O)N2CCCCC2CCl)c1 |
| InChI | InChI=1S/C16H23ClN4O/c1-12-5-6-15(20-19-8-7-18)14(10-12)16(22)21-9-3-2-4-13(21)11-17/h5-6,8,10,13,20H,2-4,7,9,11,18H2,1H3/b19-8- |
| InChIKey | GHEQEJRDFCYWQI-UWVJOHFNSA-N |
| XLogP | 2.58 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|