About 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid
2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 144938311) has the molecular formula C13H19NO3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| PubChem CID | 144938311 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C1=CCC(C)C=C1)C(=O)O |
| InChI | InChI=1S/C13H19NO3S/c1-9-3-5-10(6-4-9)12(15)14-11(13(16)17)7-8-18-2/h3,5-6,9,11H,4,7-8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | TZDTZMABPLRZDN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid?
The IUPAC name of 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid (CID 144938311) is 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid.
What is the SMILES notation for 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid?
The canonical SMILES for 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid is CSCCC(NC(=O)C1=CCC(C)C=C1)C(=O)O.
What is the InChIKey of 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid?
The InChIKey is TZDTZMABPLRZDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3S/c1-9-3-5-10(6-4-9)12(15)14-11(13(16)17)7-8-18-2/h3,5-6,9,11H,4,7-8H2,1-2H3,(H,14,15)(H,16,17).
What are the key properties of 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid?
2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid has a molecular weight of 269.37 g/mol, XLogP of 1.83, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methylcyclohexa-1,5-diene-1-carbonyl)amino]-4-methylsulfanylbutanoic acid is sourced from PubChem (CID 144938311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).