C22H28 — CID 144938549
1-cyclohexa-1,3-dien-1-yl-3-phenylbenzene;ethane (PubChem CID 144938549) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-3-phenylbenzene;ethane.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-3-phenylbenzene;ethane |
|---|---|
| PubChem CID | 144938549 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-3-phenylbenzene;ethane |
| SMILES | C1=CCCC(c2cccc(-c3ccccc3)c2)=C1.CC.CC |
| InChI | InChI=1S/C18H16.2C2H6/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;2*1-2/h1-5,7-10,12-14H,6,11H2;2*1-2H3 |
| InChIKey | FHRFVPVDGXXFAC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |