About 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen
4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen (PubChem CID 144939794) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen.
Molecular Properties
| Compound Name | 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen |
| PubChem CID | 144939794 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen |
| SMILES | CC1=C(C)OCN1.[H][H] |
| InChI | InChI=1S/C5H9NO.H2/c1-4-5(2)7-3-6-4;/h6H,3H2,1-2H3;1H |
| InChIKey | XIOUMIQLZWKPQN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen?
The IUPAC name of 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen (CID 144939794) is 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen.
What is the SMILES notation for 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen?
The canonical SMILES for 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen is CC1=C(C)OCN1.[H][H].
What is the InChIKey of 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen?
The InChIKey is XIOUMIQLZWKPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.H2/c1-4-5(2)7-3-6-4;/h6H,3H2,1-2H3;1H.
What are the key properties of 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen?
4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen has a molecular weight of 101.15 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2,3-dihydro-1,3-oxazole;molecular hydrogen is sourced from PubChem (CID 144939794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).