C8H13FN2 — CID 144939804
3-(2-fluoroethyl)-4,6-dimethyl-4H-pyrimidine (PubChem CID 144939804) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is 3-(2-fluoroethyl)-4,6-dimethyl-4H-pyrimidine.
| Compound Name | 3-(2-fluoroethyl)-4,6-dimethyl-4H-pyrimidine |
|---|---|
| PubChem CID | 144939804 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 3-(2-fluoroethyl)-4,6-dimethyl-4H-pyrimidine |
| SMILES | CC1=CC(C)N(CCF)C=N1 |
| InChI | InChI=1S/C8H13FN2/c1-7-5-8(2)11(4-3-9)6-10-7/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | NEOMFIQGVLLMDE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |