About (2-amino-4-methylpentyl) hypofluorite
(2-amino-4-methylpentyl) hypofluorite (PubChem CID 144939849) has the molecular formula C6H14FNO
and a molecular weight of 135.18 g/mol. Its IUPAC name is (2-amino-4-methylpentyl) hypofluorite.
Molecular Properties
| Compound Name | (2-amino-4-methylpentyl) hypofluorite |
| PubChem CID | 144939849 |
| Molecular Formula | C6H14FNO |
| Molecular Weight | 135.18 g/mol |
| Exact Mass | 135.11 |
| IUPAC Name | (2-amino-4-methylpentyl) hypofluorite |
| SMILES | CC(C)CC(N)COF |
| InChI | InChI=1S/C6H14FNO/c1-5(2)3-6(8)4-9-7/h5-6H,3-4,8H2,1-2H3 |
| InChIKey | VKQJGLMXEZJVHI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-amino-4-methylpentyl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-methylpentyl) hypofluorite?
The IUPAC name of (2-amino-4-methylpentyl) hypofluorite (CID 144939849) is (2-amino-4-methylpentyl) hypofluorite.
What is the SMILES notation for (2-amino-4-methylpentyl) hypofluorite?
The canonical SMILES for (2-amino-4-methylpentyl) hypofluorite is CC(C)CC(N)COF.
What is the InChIKey of (2-amino-4-methylpentyl) hypofluorite?
The InChIKey is VKQJGLMXEZJVHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14FNO/c1-5(2)3-6(8)4-9-7/h5-6H,3-4,8H2,1-2H3.
What are the key properties of (2-amino-4-methylpentyl) hypofluorite?
(2-amino-4-methylpentyl) hypofluorite has a molecular weight of 135.18 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-methylpentyl) hypofluorite is sourced from PubChem (CID 144939849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).