About N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane
N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane (PubChem CID 144940333) has the molecular formula C15H21N3O2S
and a molecular weight of 307.42 g/mol. Its IUPAC name is N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane.
Molecular Properties
| Compound Name | N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane |
| PubChem CID | 144940333 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane |
| SMILES | CC.CC(=O)NC1=NN(C(C)=O)C(C)(c2ccccc2)S1 |
| InChI | InChI=1S/C13H15N3O2S.C2H6/c1-9(17)14-12-15-16(10(2)18)13(3,19-12)11-7-5-4-6-8-11;1-2/h4-8H,1-3H3,(H,14,15,17);1-2H3 |
| InChIKey | IYQQSUFNFBUTCI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane?
The IUPAC name of N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane (CID 144940333) is N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane.
What is the SMILES notation for N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane?
The canonical SMILES for N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane is CC.CC(=O)NC1=NN(C(C)=O)C(C)(c2ccccc2)S1.
What is the InChIKey of N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane?
The InChIKey is IYQQSUFNFBUTCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S.C2H6/c1-9(17)14-12-15-16(10(2)18)13(3,19-12)11-7-5-4-6-8-11;1-2/h4-8H,1-3H3,(H,14,15,17);1-2H3.
What are the key properties of N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane?
N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane has a molecular weight of 307.42 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetyl-5-methyl-5-phenyl-1,3,4-thiadiazol-2-yl)acetamide;ethane is sourced from PubChem (CID 144940333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).