C22H29F3N4O4 — CID 144940492
(2E)-N-[2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4-dienamide (PubChem CID 144940492) has the molecular formula C22H29F3N4O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is (2E)-N-[2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4-dienamide.
| Compound Name | (2E)-N-[2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 144940492 |
| Molecular Formula | C22H29F3N4O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (2E)-N-[2-(1,3-dimethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-2-oxoethyl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4-dienamide |
| SMILES | C=C(C)/C(=C\C(=CCC)C(F)(F)F)C(=O)NCC(=O)N1CCC2(CC1)C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C22H29F3N4O4/c1-6-7-15(22(23,24)25)12-16(14(2)3)18(31)26-13-17(30)29-10-8-21(9-11-29)19(32)27(4)20(33)28(21)5/h7,12H,2,6,8-11,13H2,1,3-5H3,(H,26,31)/b15-7?,16-12+ |
| InChIKey | PKPFYQCLNYGZSI-JJGARPFQSA-N |
| XLogP | 2.39 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|