C38H43N5O — CID 144941107
3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-methoxy-1H-indole;3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-pyrrolo[2,3-b]pyridine;ethane (PubChem CID 144941107) has the molecular formula C38H43N5O and a molecular weight of 585.80 g/mol. Its IUPAC name is 3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-methoxy-1H-indole;3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-pyrrolo[2,3-b]pyridine;ethane.
| Compound Name | 3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-methoxy-1H-indole;3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-pyrrolo[2,3-b]pyridine;ethane |
|---|---|
| PubChem CID | 144941107 |
| Molecular Formula | C38H43N5O |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.35 |
| IUPAC Name | 3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-5-methoxy-1H-indole;3-(3,3-dimethyl-1,2-dihydroindol-2-yl)-1H-pyrrolo[2,3-b]pyridine;ethane |
| SMILES | CC.CC1(C)c2ccccc2NC1c1c[nH]c2ncccc12.COc1ccc2[nH]cc(C3Nc4ccccc4C3(C)C)c2c1 |
| InChI | InChI=1S/C19H20N2O.C17H17N3.C2H6/c1-19(2)15-6-4-5-7-17(15)21-18(19)14-11-20-16-9-8-12(22-3)10-13(14)16;1-17(2)13-7-3-4-8-14(13)20-15(17)12-10-19-16-11(12)6-5-9-18-16;1-2/h4-11,18,20-21H,1-3H3;3-10,15,20H,1-2H3,(H,18,19);1-2H3 |
| InChIKey | WJVMXGJYIMQIFQ-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |