About 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane
4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane (PubChem CID 144941358) has the molecular formula C13H14Cl2N2O
and a molecular weight of 285.17 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane.
Molecular Properties
| Compound Name | 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane |
| PubChem CID | 144941358 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane |
| SMILES | CC.Nc1ccc(Oc2cc(Cl)nc(Cl)c2)cc1 |
| InChI | InChI=1S/C11H8Cl2N2O.C2H6/c12-10-5-9(6-11(13)15-10)16-8-3-1-7(14)2-4-8;1-2/h1-6H,14H2;1-2H3 |
| InChIKey | WFJZBEFLCJSYHM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane?
The IUPAC name of 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane (CID 144941358) is 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane.
What is the SMILES notation for 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane?
The canonical SMILES for 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane is CC.Nc1ccc(Oc2cc(Cl)nc(Cl)c2)cc1.
What is the InChIKey of 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane?
The InChIKey is WFJZBEFLCJSYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N2O.C2H6/c12-10-5-9(6-11(13)15-10)16-8-3-1-7(14)2-4-8;1-2/h1-6H,14H2;1-2H3.
What are the key properties of 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane?
4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane has a molecular weight of 285.17 g/mol, XLogP of 4.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichloro-4-pyridinyl)oxy]aniline;ethane is sourced from PubChem (CID 144941358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).