C15H33NO — CID 144941414
4,4-dimethyl-1-(oxetan-3-ylmethyl)piperidine;ethane (PubChem CID 144941414) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is 4,4-dimethyl-1-(oxetan-3-ylmethyl)piperidine;ethane.
| Compound Name | 4,4-dimethyl-1-(oxetan-3-ylmethyl)piperidine;ethane |
|---|---|
| PubChem CID | 144941414 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 4,4-dimethyl-1-(oxetan-3-ylmethyl)piperidine;ethane |
| SMILES | CC.CC.CC1(C)CCN(CC2COC2)CC1 |
| InChI | InChI=1S/C11H21NO.2C2H6/c1-11(2)3-5-12(6-4-11)7-10-8-13-9-10;2*1-2/h10H,3-9H2,1-2H3;2*1-2H3 |
| InChIKey | YAFKUAGFQSOREJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |