C30H37NO2 — CID 144941608
15-(3,4-dimethyloct-5-en-4-yl)-20,20-dimethyl-3,6-dioxa-12-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),8,10,12,14(19),17-heptaene (PubChem CID 144941608) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is 15-(3,4-dimethyloct-5-en-4-yl)-20,20-dimethyl-3,6-dioxa-12-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),8,10,12,14(19),17-heptaene.
| Compound Name | 15-(3,4-dimethyloct-5-en-4-yl)-20,20-dimethyl-3,6-dioxa-12-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),8,10,12,14(19),17-heptaene |
|---|---|
| PubChem CID | 144941608 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 15-(3,4-dimethyloct-5-en-4-yl)-20,20-dimethyl-3,6-dioxa-12-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),8,10,12,14(19),17-heptaene |
| SMILES | CCC=CC(C)(C(C)CC)C1CC=CC2=C1c1nccc3cc4c(c(c13)C2(C)C)OCCO4 |
| InChI | InChI=1S/C30H37NO2/c1-7-9-14-30(6,19(3)8-2)22-12-10-11-21-25(22)27-24-20(13-15-31-27)18-23-28(33-17-16-32-23)26(24)29(21,4)5/h9-11,13-15,18-19,22H,7-8,12,16-17H2,1-6H3 |
| InChIKey | AEWFHPCVTGDQET-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|