C19H22F3N5O3S2 — CID 144942364
N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(trifluoromethoxy)pyridine-2-carboxamide;ethane (PubChem CID 144942364) has the molecular formula C19H22F3N5O3S2 and a molecular weight of 489.55 g/mol. Its IUPAC name is N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(trifluoromethoxy)pyridine-2-carboxamide;ethane.
| Compound Name | N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(trifluoromethoxy)pyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144942364 |
| Molecular Formula | C19H22F3N5O3S2 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-[2-(2-amino-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-1,3-thiazol-4-yl]-5-(trifluoromethoxy)pyridine-2-carboxamide;ethane |
| SMILES | CC.NC1=NC2(c3nc(NC(=O)c4ccc(OC(F)(F)F)cn4)cs3)COCCC2CS1 |
| InChI | InChI=1S/C17H16F3N5O3S2.C2H6/c18-17(19,20)28-10-1-2-11(22-5-10)13(26)23-12-7-29-14(24-12)16-8-27-4-3-9(16)6-30-15(21)25-16;1-2/h1-2,5,7,9H,3-4,6,8H2,(H2,21,25)(H,23,26);1-2H3 |
| InChIKey | ISQMUYVWYZREJD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |