C41H30N3+ — CID 144943069
5-[3-(1,4-diphenyl-1,3-diazet-1-ium-2-yl)phenyl]-11,11-dimethylindeno[1,2-b]carbazole (PubChem CID 144943069) has the molecular formula C41H30N3+ and a molecular weight of 564.71 g/mol. Its IUPAC name is 5-[3-(1,4-diphenyl-1,3-diazet-1-ium-2-yl)phenyl]-11,11-dimethylindeno[1,2-b]carbazole.
| Compound Name | 5-[3-(1,4-diphenyl-1,3-diazet-1-ium-2-yl)phenyl]-11,11-dimethylindeno[1,2-b]carbazole |
|---|---|
| PubChem CID | 144943069 |
| Molecular Formula | C41H30N3+ |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 5-[3-(1,4-diphenyl-1,3-diazet-1-ium-2-yl)phenyl]-11,11-dimethylindeno[1,2-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)c1ccccc1n3-c1cccc(C2=[N+](c3ccccc3)C(c3ccccc3)=N2)c1 |
| InChI | InChI=1S/C41H30N3/c1-41(2)35-22-11-9-20-31(35)33-26-38-34(25-36(33)41)32-21-10-12-23-37(32)43(38)30-19-13-16-28(24-30)40-42-39(27-14-5-3-6-15-27)44(40)29-17-7-4-8-18-29/h3-26H,1-2H3/q+1 |
| InChIKey | LAIUYYQRGYOFPB-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|